CymitQuimica logo

CAS 116140-16-0

:

6-Methyl-3-piperidinecarboxylic acid

Description:
6-Methyl-3-piperidinecarboxylic acid is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group (-COOH) and a methyl group (-CH3) attached to the piperidine ring, specifically at the 6th and 3rd positions, respectively. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The piperidine ring contributes to the compound's basicity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. Typically, compounds like 6-Methyl-3-piperidinecarboxylic acid are of interest in medicinal chemistry and organic synthesis due to their potential biological activity and utility as intermediates in the synthesis of pharmaceuticals. Its molecular structure and functional groups suggest that it may exhibit specific interactions with biological targets, making it a candidate for further research in drug development.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-5-2-3-6(4-8-5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)
InChI key:InChIKey=ITWDDDADSFZADI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCC(C)NC1
Synonyms:
  • 6-Methyl-3-piperidinecarboxylic acid
  • 3-Piperidinecarboxylic acid, 6-methyl-
Found 2 products.