CymitQuimica logo

CAS 116140-49-9

:

3-methylpiperidine-3-carboxylic acid

Description:
3-Methylpiperidine-3-carboxylic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a methyl group at the third position of the piperidine ring and a carboxylic acid functional group at the same position contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid group, which can engage in hydrogen bonding. The compound exhibits basic properties due to the nitrogen atom in the piperidine ring, allowing it to act as a weak base. Its carboxylic acid functionality can participate in various chemical reactions, including esterification and amidation. 3-Methylpiperidine-3-carboxylic acid is of interest in organic synthesis and pharmaceutical applications, particularly in the development of biologically active compounds. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-7(6(9)10)3-2-4-8-5-7/h8H,2-5H2,1H3,(H,9,10)
InChI key:DEMOKNSWMVAJPZ-UHFFFAOYSA-N
SMILES:CC1(CCCNC1)C(=O)O
Found 3 products.