CAS 1161497-23-9: 3-Bromo-4-fluoroanisole

Description:3-Bromo-4-fluoroanisole is an organic compound characterized by the presence of both bromine and fluorine substituents on an anisole structure, which consists of a methoxy group (-OCH3) attached to a benzene ring. The bromine atom is located at the meta position (3-position) relative to the methoxy group, while the fluorine atom is at the para position (4-position). This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in pharmaceuticals and agrochemicals due to the reactivity of the halogen substituents, which can participate in various chemical reactions such as nucleophilic substitutions. The presence of both bromine and fluorine can influence the compound's physical properties, such as boiling point and solubility, as well as its reactivity and stability. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.

Formula:C₇H₆BrFO

InChI:InChI=1S/C7H6BrFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3

Synonyms:
Benzene, 2-bromo-1-fluoro-4-methoxy-
2-Bromo-1-fluoro-4-methoxybenzene

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3-Bromo-4-fluoroanisole REF: IN-DA000BRCCAS: 1161497-23-9	95%	To inquire	Tue 01 Apr 25
3-Bromo-4-fluoroanisole REF: 54-PC49237CAS: 1161497-23-9	By gc: 98.13% (Typical Value in Batch COA)	32.00 €~36.00 €	Mon 31 Mar 25
2-Bromo-1-fluoro-4-methoxybenzene REF: 10-F079273CAS: 1161497-23-9	95.0%	24.00 €~785.00 €	Wed 02 Apr 25
2-bromo-1-fluoro-4-methoxybenzene REF: 3D-FB105370CAS: 1161497-23-9	Min. 95%	- - -	Discontinued product