CymitQuimica logo

CAS 116170-90-2

:

ethyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate

Description:
Ethyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate, with the CAS number 116170-90-2, is a chemical compound that belongs to the class of thiophene derivatives. This substance features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, contributing to its unique electronic properties. The presence of an amino group and a cyano group enhances its reactivity and potential applications in organic synthesis and pharmaceuticals. The methylthio group adds to its structural complexity and may influence its solubility and interaction with biological systems. Ethyl ester functionality suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may be relevant in various chemical reactions. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its specific characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C9H10N2O2S2
InChI:InChI=1/C9H10N2O2S2/c1-3-13-8(12)7-6(11)5(4-10)9(14-2)15-7/h3,11H2,1-2H3
InChI key:BMYKQPLSSCCDQS-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(c(C#N)c(SC)s1)N
Synonyms:
  • Ethyl 3-Amino-4-Cyano-5-(Methylsulfanyl)Thiophene-2-Carboxylate
Found 4 products.