CymitQuimica logo

CAS 116178-39-3

:

3-Pyridinol,6-ethoxy-(9CI)

Description:
3-Pyridinol, 6-ethoxy- (9CI), with the CAS number 116178-39-3, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethoxy group (-OCH2CH3) at the 6-position and a hydroxyl group (-OH) at the 3-position of the pyridine ring, contributing to its unique chemical properties. The presence of these functional groups suggests that 3-Pyridinol, 6-ethoxy- may exhibit both polar and nonpolar characteristics, influencing its solubility in various solvents. It is likely to participate in hydrogen bonding due to the hydroxyl group, which can affect its reactivity and interactions with other molecules. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. However, specific applications and safety data should be referenced from reliable sources for practical use.
Formula:C7H9NO2
InChI:InChI=1S/C7H9NO2/c1-2-10-7-4-3-6(9)5-8-7/h3-5,9H,2H2,1H3
InChI key:BBEYKPDYKSDPNA-UHFFFAOYSA-N
SMILES:CCOC1=NC=C(C=C1)O
Found 3 products.