CymitQuimica logo

CAS 116209-30-4

:

4-BROMO-2-MERCAPTOBENZOIC ACID

Description:
4-Bromo-2-mercaptobenzoic acid is an organic compound characterized by the presence of a bromine atom and a thiol (-SH) group attached to a benzoic acid structure. Its molecular formula typically includes a benzene ring substituted with a bromine atom at the para position and a mercapto group at the ortho position relative to the carboxylic acid group. This compound is known for its potential applications in medicinal chemistry and as a reagent in organic synthesis due to the reactivity of the thiol group. The presence of the bromine atom can enhance the compound's electrophilic properties, making it useful in various chemical reactions. Additionally, the mercapto group can participate in redox reactions and form disulfide bonds, which are significant in biological systems. 4-Bromo-2-mercaptobenzoic acid is typically handled with care due to its potential toxicity and the need for appropriate safety measures in laboratory settings. Its solubility and stability can vary depending on the solvent and environmental conditions.
Formula:C7H5BrO2S
InChI:InChI=1S/C7H5BrO2S/c8-4-1-2-5(7(9)10)6(11)3-4/h1-3,11H,(H,9,10)
InChI key:ZHNJGPZUGQGIGC-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1Br)S)C(=O)O
Found 2 products.