CAS 116247-46-2: 2,5-Dihydro-3-phenyl-5-(phenylmethylene)-1,2,4-triazin-6(1H)-one

Description:2,5-Dihydro-3-phenyl-5-(phenylmethylene)-1,2,4-triazin-6(1H)-one is a heterocyclic organic compound characterized by its triazine ring structure, which incorporates nitrogen atoms into a six-membered ring. This compound features a phenylmethylene group and a phenyl substituent, contributing to its aromatic properties and potential for various chemical interactions. The presence of the triazine moiety suggests that it may exhibit interesting biological activities, including potential antimicrobial or antitumor properties, although specific biological data would need to be referenced for confirmation. The compound is likely to be soluble in organic solvents due to its aromatic nature, while its stability and reactivity can be influenced by the substituents on the triazine ring. Additionally, the presence of the carbonyl group in the triazine structure may allow for hydrogen bonding and further chemical reactivity. Overall, this compound represents a class of triazine derivatives that could be of interest in medicinal chemistry and materials science.

Formula:C₁₆H₁₃N₃O

InChI:InChI=1S/C16H13N3O/c20-16-14(11-12-7-3-1-4-8-12)17-15(18-19-16)13-9-5-2-6-10-13/h1-11H,(H,17,18)(H,19,20)

InChI key:InChIKey=CIBSDTJVSDOTJL-UHFFFAOYSA-N

SMILES:O=C1NN=C(NC1=CC=2C=CC=CC2)C=3C=CC=CC3