CymitQuimica logo

CAS 116265-66-8

:

perfluorobenzyl tetralin

Description:
Perfluorobenzyl tetralin, identified by its CAS number 116265-66-8, is a synthetic chemical compound characterized by its unique structure, which includes a perfluorinated benzyl group attached to a tetralin moiety. This compound is notable for its high thermal stability and low surface tension, properties that are often attributed to the presence of fluorine atoms, which enhance its chemical resilience and hydrophobic characteristics. Perfluorobenzyl tetralin is typically colorless and odorless, making it suitable for various applications in the fields of materials science and chemical engineering. Its perfluorinated nature imparts significant resistance to chemical reactions, making it useful in environments where conventional organic solvents might degrade. Additionally, it may exhibit low toxicity and environmental persistence, which are important considerations in its application and handling. Overall, perfluorobenzyl tetralin represents a class of compounds that combine the benefits of fluorination with the structural features of aromatic hydrocarbons, leading to diverse potential uses in advanced materials and specialty chemicals.
Formula:C17F30
InChI:InChI=1/C17F30/c18-1-2(19,9(30,31)14(40,41)13(38,39)8(1,28)29)7(26,27)10(32,33)3(20,5(1,22)23)6(24,25)4(21)11(34,35)15(42,43)17(46,47)16(44,45)12(4,36)37
InChI key:DFGLLDMCDAKADU-UHFFFAOYSA-N
SMILES:C12(C(C(C(C(C1(F)F)(C(C1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)F)(F)F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F
Synonyms:
  • Perfluorobenzyltetralin
  • 2-[Difluoro-(1,2,2,3,3,4,4,5,5,6,6-Undecafluorocyclohexyl)Methyl]-1,1,2,3,3,4,4,4A,5,5,6,6,7,7,8,8,8A-Heptadecafluoro-Decalin
Found 2 products.