CymitQuimica logo

CAS 1162674-74-9

:

5-Bromo-3-fluoro-2-methylpyridine

Description:
5-Bromo-3-fluoro-2-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with bromine, fluorine, and a methyl group. The presence of these halogen substituents significantly influences its chemical reactivity and physical properties. Typically, compounds like this exhibit polar characteristics due to the electronegative halogens, which can enhance their solubility in polar solvents. The bromine and fluorine atoms can also participate in various chemical reactions, making this compound useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The methyl group contributes to the overall hydrophobic character of the molecule, affecting its interactions with biological systems. Additionally, the compound may exhibit distinct spectral properties, such as specific absorption peaks in NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, 5-Bromo-3-fluoro-2-methylpyridine is a valuable compound in research and industrial applications due to its unique structural features and reactivity.
Formula:C6H5BrFN
InChI:InChI=1S/C6H5BrFN/c1-4-6(8)2-5(7)3-9-4/h2-3H,1H3
InChI key:KQCSRDNKPIPYIS-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=N1)Br)F
Found 5 products.