CymitQuimica logo

CAS 116269-85-3

:

4-(3-Methoxyphenyl)-2(3H)-thiazolone

Description:
4-(3-Methoxyphenyl)-2(3H)-thiazolone, identified by its CAS number 116269-85-3, is a chemical compound characterized by its thiazolone structure, which features a five-membered ring containing both sulfur and nitrogen atoms. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, making it useful in various chemical applications. The presence of the methoxyphenyl group contributes to its potential as a ligand in coordination chemistry and may enhance its reactivity in organic synthesis. Additionally, thiazolone derivatives are known for their biological activities, including antimicrobial and anti-inflammatory properties, which may be relevant for pharmaceutical research. The compound's stability and reactivity can be influenced by the substituents on the aromatic ring, and it may undergo various chemical transformations, such as nucleophilic substitutions or cyclization reactions. Overall, 4-(3-Methoxyphenyl)-2(3H)-thiazolone represents a versatile structure in organic chemistry with potential applications in medicinal chemistry and materials science.
Formula:C10H9NO2S
InChI:InChI=1S/C10H9NO2S/c1-13-8-4-2-3-7(5-8)9-6-14-10(12)11-9/h2-6H,1H3,(H,11,12)
InChI key:InChIKey=FMROXOWLZSPZIM-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1)C=2NC(=O)SC2
Synonyms:
  • 4-(3-Methoxyphenyl)-2(3H)-thiazolone
  • 4-(m-Methoxyphenyl)-2(3H)-thiazolone
  • 2(3H)-Thiazolone, 4-(3-methoxyphenyl)-
Found 1 products.