CymitQuimica logo

CAS 116272-42-5

:

5-CHLORO-2-FLUOROIODOBENZENE

Description:
5-Chloro-2-fluoroiodobenzene is an aromatic halogenated compound characterized by the presence of three halogen substituents on a benzene ring: chlorine, fluorine, and iodine. The molecular structure features a benzene ring with a chlorine atom at the 5-position and both a fluorine and an iodine atom at the 2-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity due to the presence of multiple halogens, which can influence its chemical behavior, including its potential use in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of these halogens can also affect the compound's polarity, solubility, and boiling point. Safety precautions should be taken when handling this substance, as halogenated compounds can be toxic and environmentally hazardous. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C6H3ClFI
InChI:InChI=1/C6H3ClFI/c7-4-1-2-5(8)6(9)3-4/h1-3H
InChI key:CNJQPBYTHITJAO-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Cl)I)F
Synonyms:
  • 4-Chloro-1-Fluoro-2-Iodobenzene
Found 4 products.