CAS 116277-67-9
:2-CARBOXYPHENYLPHOSPHONIC ACID
Description:
2-Carboxyphenylphosphonic acid, with the CAS number 116277-67-9, is an organophosphorus compound characterized by the presence of both a carboxylic acid and a phosphonic acid functional group. This compound typically appears as a white to off-white solid and is soluble in water, which enhances its utility in various applications. The presence of the carboxylic acid group contributes to its acidity and potential reactivity, while the phosphonic acid group imparts unique properties, such as chelation with metal ions. This compound is often studied for its role in biochemical applications, particularly in the context of enzyme inhibition and as a potential ligand in coordination chemistry. Its structural features allow it to participate in hydrogen bonding and other intermolecular interactions, making it relevant in both synthetic and biological chemistry. Additionally, 2-carboxyphenylphosphonic acid may exhibit interesting properties in materials science, particularly in the development of phosphonate-based materials.
Formula:C7H7O5P
InChI:InChI=1S/C7H7O5P/c8-7(9)5-3-1-2-4-6(5)13(10,11)12/h1-4H,(H,8,9)(H2,10,11,12)
InChI key:DQULYJXGTXMNTM-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C(=O)O)P(=O)(O)O
Synonyms:- 2-Carboxyphenylphosphonic acid, 98 %
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
