CymitQuimica logo

CAS 116286-81-8

:

1-((tert-butyldimethylsilyl)oxy)propan-2-ol

Description:
1-((tert-butyldimethylsilyl)oxy)propan-2-ol, with the CAS number 116286-81-8, is an organic compound characterized by the presence of a tert-butyldimethylsilyl (TBDMS) protecting group attached to a propan-2-ol moiety. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents such as dichloromethane and ether, while being less soluble in water due to its hydrophobic silyl group. The TBDMS group serves as a protective group for hydroxyl functionalities, making this compound useful in synthetic organic chemistry, particularly in the protection and deprotection of alcohols during multi-step synthesis. The presence of the silyl ether bond enhances the stability of the alcohol against acidic conditions, allowing for selective reactions. Additionally, the compound may exhibit moderate volatility and can be sensitive to moisture, necessitating careful handling and storage. Overall, its unique structure and properties make it a valuable intermediate in various chemical syntheses.
Formula:C9H22O2Si
InChI:InChI=1S/C9H22O2Si/c1-8(10)7-11-12(5,6)9(2,3)4/h8,10H,7H2,1-6H3
InChI key:BJDDRAYUVSVPPR-UHFFFAOYSA-N
SMILES:CC(CO[Si](C)(C)C(C)(C)C)O
Found 3 products.