CymitQuimica logo

CAS 1163135-95-2

:

5,6-trans-Bimatoprost

Description:
5,6-trans-Bimatoprost, identified by its CAS number 1163135-95-2, is a synthetic prostaglandin analog primarily used in ophthalmology for the treatment of glaucoma and ocular hypertension. This compound is characterized by its ability to increase the outflow of aqueous humor, thereby reducing intraocular pressure. Structurally, it features a long hydrocarbon chain with specific functional groups that contribute to its biological activity. The "trans" configuration at the 5 and 6 positions indicates the geometric arrangement of the molecule, which is crucial for its interaction with the prostaglandin receptors. Bimatoprost is known for its potency and selectivity, making it effective in promoting eyelash growth as well. It is typically administered as an eye drop solution and is well-tolerated, although some users may experience side effects such as eye irritation or changes in eyelash pigmentation. Overall, 5,6-trans-Bimatoprost exemplifies the application of synthetic compounds in therapeutic settings, particularly in managing ocular conditions.
Formula:C25H37NO4
InChI:InChI=1S/C25H37NO4/c1-2-26-25(30)13-9-4-3-8-12-21-22(24(29)18-23(21)28)17-16-20(27)15-14-19-10-6-5-7-11-19/h3,5-8,10-11,16-17,20-24,27-29H,2,4,9,12-15,18H2,1H3,(H,26,30)/b8-3+,17-16+/t20-,21+,22+,23-,24+/m0/s1
InChI key:AQOKCDNYWBIDND-ABRBVVEGSA-N
SMILES:CCNC(=O)CCC/C=C/C[C@H]1[C@H](C[C@H]([C@@H]1/C=C/[C@H](CCC2=CC=CC=C2)O)O)O
Found 9 products.