CymitQuimica logo

CAS 1163141-57-8

:

3-cyano-5-hydroxybenzoic acid

Description:
3-Cyano-5-hydroxybenzoic acid is an organic compound characterized by the presence of a cyano group (-CN) and a hydroxyl group (-OH) attached to a benzoic acid framework. This compound features a benzene ring with a carboxylic acid group (-COOH) and is known for its potential applications in pharmaceuticals and organic synthesis. The cyano group contributes to its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and as a building block in the synthesis of more complex molecules. The hydroxyl group enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its physical properties. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. Overall, 3-cyano-5-hydroxybenzoic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C8H5NO3
InChI:InChI=1S/C8H5NO3/c9-4-5-1-6(8(11)12)3-7(10)2-5/h1-3,10H,(H,11,12)
InChI key:AIJZBNIPPCUFCO-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1C(=O)O)O)C#N
Found 5 products.