CymitQuimica logo

CAS 1163248-54-1

:

(5-Methyl-1H-Pyrazol-3-Yl)Boronic Acid

Description:
(5-Methyl-1H-Pyrazol-3-Yl)Boronic Acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrazole ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the methyl group on the pyrazole ring can influence its reactivity and solubility, as well as its interaction with biological targets. Additionally, this compound may exhibit properties such as acidity due to the boronic acid group, which can form reversible complexes with diols, making it useful in sensing applications. Overall, (5-Methyl-1H-Pyrazol-3-Yl)Boronic Acid is a versatile building block in the synthesis of complex organic molecules and has potential applications in drug discovery and materials science.
Formula:C4H7BN2O2
InChI:InChI=1S/C4H7BN2O2/c1-3-2-4(5(8)9)7-6-3/h2,8-9H,1H3,(H,6,7)
InChI key:VWENLWUOIPCRRJ-UHFFFAOYSA-N
SMILES:Cc1cc(B(O)O)n[nH]1
Synonyms:
  • B-(5-methyl-1H-pyrazol-3-yl)Boronic acid
  • 5-Methyl-1H-pyrazol-3-yl hydrogen boronate
  • beta-(5-Methyl-1H-pyrazol-3-yl)boronic acid
  • Boronic acid, B-(5-methyl-1H-pyrazol-3-yl)-
Found 4 products.