CymitQuimica logo

CAS 116332-62-8

:

N-METHOXY-N-METHYL-3-(TRIFLUOROMETHYL)BENZENECARBOXAMIDE

Description:
N-Methoxy-N-methyl-3-(trifluoromethyl)benzenecarboxamide, with the CAS number 116332-62-8, is a chemical compound characterized by its unique functional groups and structure. It features a methoxy group (-OCH3) and a methyl group (-CH3) attached to a nitrogen atom, which contributes to its amide functionality. The presence of a trifluoromethyl group (-CF3) on the aromatic ring enhances its lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the trifluoromethyl group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, where modifications to the aromatic system can affect binding affinity and selectivity. Additionally, the trifluoromethyl group is known to impart unique electronic properties, making this compound of interest in medicinal chemistry and material science. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C10H10F3NO2
InChI:InChI=1S/C10H10F3NO2/c1-14(16-2)9(15)7-4-3-5-8(6-7)10(11,12)13/h3-6H,1-2H3
InChI key:PAXXRRIUUCZPEU-UHFFFAOYSA-N
SMILES:CN(C(=O)C1=CC(=CC=C1)C(F)(F)F)OC
Synonyms:
  • N-Methoxy-N-methyl-3-(trifluoromethyl)benzamide
  • N-Methoxy-N-methyl-3-trifluoromethylbenzamide
Found 2 products.