CymitQuimica logo

CAS 116345-47-2

:

1H-Benzimidazole-2-methanol,4-hydroxy-(9CI)

Description:
1H-Benzimidazole-2-methanol, 4-hydroxy- (9CI), with the CAS number 116345-47-2, is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a hydroxymethyl group at the 2-position and a hydroxyl group at the 4-position of the benzimidazole ring, contributing to its potential as a bioactive molecule. The presence of these functional groups suggests that it may exhibit various chemical properties, including solubility in polar solvents and potential hydrogen bonding capabilities. Such characteristics often influence its reactivity and interactions in biological systems, making it of interest in medicinal chemistry and pharmacology. The compound may also display antioxidant or antimicrobial properties, which are common in derivatives of benzimidazole. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C8H8N2O2
InChI:InChI=1S/C8H8N2O2/c11-4-7-9-5-2-1-3-6(12)8(5)10-7/h1-3,11-12H,4H2,(H,9,10)
InChI key:KROOLBGYYVWEIA-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)O)N=C(N2)CO
Found 4 products.