CymitQuimica logo

CAS 116355-19-2

:

6-Bromo-5-methylimidazo[1,2-a]pyridine

Description:
6-Bromo-5-methylimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 6-position and a methyl group at the 5-position of the imidazo ring influences its reactivity and solubility. This compound is typically a solid at room temperature and exhibits moderate polarity due to the nitrogen atoms in its structure. It is known for its potential biological activity, particularly in the context of mutagenicity and carcinogenicity, as it is a derivative of imidazoquinoline compounds. The compound's structure allows for various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, its unique properties may lead to applications in research related to cancer biology and pharmacology. Safety precautions should be observed when handling this compound due to its potential health risks.
Formula:C8H7BrN2
InChI:InChI=1S/C8H7BrN2/c1-6-7(9)2-3-8-10-4-5-11(6)8/h2-5H,1H3
InChI key:InChIKey=UGRZKLCCPTTZKM-UHFFFAOYSA-N
SMILES:CC=1N2C(C=CC1Br)=NC=C2
Synonyms:
  • 6-Bromo-5-methylimidazo[1,2-a]pyridine
  • Imidazo[1,2-a]pyridine, 6-bromo-5-methyl-
Found 4 products.