CAS 116355-83-0: Fumonisin B1
Description:Fumonisin B1 is a mycotoxin produced by certain species of fungi, particularly Fusarium verticillioides and Fusarium proliferatum, which commonly contaminate maize and other crops. It is classified as a secondary metabolite and is known for its structural similarity to sphingolipids, which can interfere with sphingolipid metabolism in living organisms. Fumonisin B1 is a white to off-white crystalline solid, soluble in polar solvents like water and methanol, but insoluble in non-polar solvents. Its toxicity is primarily associated with its potential to cause various health issues, including esophageal cancer in humans and leukoencephalomalacia in horses. The compound has been shown to disrupt cellular processes, leading to apoptosis and other adverse effects in animal models. Regulatory agencies monitor fumonisin levels in food products due to its health implications, and it is important for agricultural practices to minimize its occurrence in crops. Overall, Fumonisin B1 poses significant risks to both human and animal health, necessitating ongoing research and monitoring.
Formula:C34H59NO15
InChI:InChI=1S/C34H59NO15/c1-5-6-9-20(3)32(50-31(44)17-23(34(47)48)15-29(41)42)27(49-30(43)16-22(33(45)46)14-28(39)40)13-19(2)12-24(36)10-7-8-11-25(37)18-26(38)21(4)35/h19-27,32,36-38H,5-18,35H2,1-4H3,(H,39,40)(H,41,42)(H,45,46)(H,47,48)/t19-,20+,21-,22+,23+,24+,25+,26-,27-,32+/m0/s1
InChI key:InChIKey=UVBUBMSSQKOIBE-DSLOAKGESA-N
SMILES:O=C(O)CC(C(=O)O)CC(=O)OC(CC(C)CC(O)CCCCC(O)CC(O)C(N)C)C(OC(=O)CC(C(=O)O)CC(=O)O)C(C)CCCC
- Synonyms:
- 1,2,3-Propanetricarboxylic acid, 1,1'-[1-(12-amino-4,9,11-trihydroxy-2-methyltridecyl)-2-(1-methylpentyl)-1,2-ethanediyl] ester, [2S-[1[1R*(S*),2S*(S*),2(S*)],2R*,4S*,9S*,11R*,12R*]]-
- 1,2,3-Propanetricarboxylic acid, 1,1′-[(1S,2R)-1-[(2S,4R,9R,11S,12S)-12-amino-4,9,11-trihydroxy-2-methyltridecyl]-2-[(1R)-1-methylpentyl]-1,2-ethanediyl] ester, (2R,2′R)-
- Fumonisin B1
- Fumonisin B<sub>1</sub>
