CymitQuimica logo

CAS 1163707-53-6

:

3,3,3-Trifluoro-2,2-dimethylpropanoyl chloride

Description:
3,3,3-Trifluoro-2,2-dimethylpropanoyl chloride is an organofluorine compound characterized by the presence of trifluoromethyl and acyl chloride functional groups. This compound features a central carbon backbone with two methyl groups and a trifluoromethyl group attached to the second carbon, while the acyl chloride functional group is located at the end of the carbon chain. The presence of the trifluoromethyl group imparts unique properties, such as increased lipophilicity and stability, while the acyl chloride functionality makes it a reactive species, particularly in nucleophilic substitution reactions. This compound is typically used in organic synthesis, particularly in the preparation of fluorinated compounds and pharmaceuticals. Its reactivity allows it to participate in various chemical transformations, making it valuable in synthetic chemistry. Additionally, due to the presence of chlorine and fluorine, it may exhibit specific environmental and safety considerations, necessitating careful handling and storage. Overall, 3,3,3-Trifluoro-2,2-dimethylpropanoyl chloride is a versatile reagent in the field of organic chemistry.
Formula:C5H6ClF3O
InChI:InChI=1S/C5H6ClF3O/c1-4(2,3(6)10)5(7,8)9/h1-2H3
InChI key:InChIKey=FDLKHHYXFFZRSN-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(Cl)=O)(C)C
Synonyms:
  • Propanoyl chloride, 3,3,3-trifluoro-2,2-dimethyl-
  • 3,3,3-Trifluoro-2,2-dimethylpropanoyl chloride
Found 1 products.