CymitQuimica logo

CAS 116423-58-6

:

2-AMINO-5-HYDROXY-BENZONITRILE

Description:
2-Amino-5-hydroxy-benzenenitrile, with the CAS number 116423-58-6, is an organic compound characterized by the presence of both amino and hydroxyl functional groups attached to a benzene ring, along with a nitrile group. This compound typically appears as a solid and is soluble in polar solvents due to its functional groups. The amino group (-NH2) contributes to its basicity, while the hydroxyl group (-OH) provides potential for hydrogen bonding, influencing its reactivity and solubility. The nitrile group (-C≡N) is known for its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. This compound may be utilized in organic synthesis and pharmaceutical applications, particularly in the development of biologically active molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other substituents in the molecular structure. Overall, 2-amino-5-hydroxy-benzenenitrile is a versatile compound with significant implications in chemical research and industry.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c8-4-5-3-6(10)1-2-7(5)9/h1-3,10H,9H2
InChI key:FCZQCSIAXHUORC-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1O)C#N)N
Found 4 products.