CAS 116499-73-1

Formula: C20H30O4

InChI: InChI=1S/C20H30O4/c1-13(2)19-10-11-20(24-23-19)14(12-19)6-7-15-17(3,16(21)22)8-5-9-18(15,20)4/h12-13,15H,5-11H2,1-4H3,(H,21,22)/t15-,17+,18-,19-,20+/m0/s1

InChI key: OOHFJWCHEFCJDC-AXDKOMKPSA-N

SMILES: CC(C)[C@]12CC[C@]3(C(=C1)CC[C@@H]4[C@@]3(CCC[C@@]4(C)C(=O)O)C)OO2

9α,13α-Epidioxyabiet-8(14)-en-18-oic acid

CAS: 116499-73-1

9alpha,13alpha-Epidioxyabiet-8(14)-en-18-oic acid shows potent inhibitory effects on Epstein-Barr virus early antigen (EBV-EA) activation induced by the tumor

Formula: C₂₀H₃₀O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 334.4498

Ref: TM-TN3309

9α,13α-Epidioxyabiet-8(14)-en-18-oic acid

CAS: 116499-73-1

Formula: C₂₀H₃₀O₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 334.456

Ref: BP-SBP02449

9α,13α-Epidioxyabiet-8(14)-en-18-oic acid

CAS: 116499-73-1

9α,13α-Epidioxyabiet-8(14)-en-18-oic acid is a naturally occurring diterpenoid compound, which is derived from various terrestrial plant species, particularly those belonging to the Pinaceae family. This compound is characterized by its unique epidioxy structure, implicating its potential function in oxidative stress responses within the plant.

Formula: C₂₀H₃₀O₄

Purity: Min. 95%

Molecular weight: 334.4 g/mol

Ref: 3D-REA49973

9α,13α-Epidioxyabiet-8(14)-en-18-oic Acid

CAS: 116499-73-1

Formula: C₂₀H₃₀O₄

Purity: 97.0%

Molecular weight: 334.4498

Ref: IN-DA000CNH