CAS 116539-01-6
:3-Thiophenecarboxylicacid,5-amino-
Description:
3-Thiophenecarboxylic acid, 5-amino- is an organic compound characterized by the presence of a thiophene ring, a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group (-COOH) and an amino group (-NH2) attached to the thiophene ring, specifically at the 3 and 5 positions, respectively. The presence of these functional groups contributes to its potential as a building block in organic synthesis and medicinal chemistry. The compound is likely to exhibit acidic properties due to the carboxylic acid group, while the amino group can participate in hydrogen bonding and may influence the compound's solubility and reactivity. Additionally, the thiophene moiety can contribute to the compound's electronic properties, making it of interest in materials science and organic electronics. Overall, 3-Thiophenecarboxylic acid, 5-amino- is a versatile compound with potential applications in various chemical and pharmaceutical contexts.
Formula:C5H5NO2S
InChI:InChI=1S/C5H5NO2S/c6-4-1-3(2-9-4)5(7)8/h1-2H,6H2,(H,7,8)
InChI key:GDCXAVLSIKFZMY-UHFFFAOYSA-N
SMILES:C1=C(SC=C1C(=O)O)N
Synonyms:- 3-Thiophenecarboxylicacid,5-amino-(9CI)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
