CymitQuimica logo

CAS 116541-16-3

:

1(3H)-Isobenzofuranone, 3-butylidene-4-methoxy-, (Z)-

Description:
1(3H)-Isobenzofuranone, 3-butylidene-4-methoxy-, (Z)-, with the CAS number 116541-16-3, is an organic compound characterized by its unique structural features. It belongs to the class of isobenzofuranones, which are derivatives of isobenzofuran, a bicyclic compound. The presence of a butylidene group and a methoxy substituent contributes to its distinct chemical properties. The (Z)- configuration indicates that the butylidene group is oriented in a specific geometric arrangement, which can influence its reactivity and interactions with other molecules. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and organic synthesis. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 1(3H)-Isobenzofuranone, 3-butylidene-4-methoxy-, (Z)- represents a complex structure that may have potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H14O3
InChI:InChI=1S/C13H14O3/c1-3-4-7-11-12-9(13(14)16-11)6-5-8-10(12)15-2/h5-8H,3-4H2,1-2H3/b11-7-
InChI key:DQDDLJJXYHAFNQ-XFFZJAGNSA-N
SMILES:CCC/C=C\1/C2=C(C=CC=C2OC)C(=O)O1
Found 1 products.