CymitQuimica logo

CAS 116547-92-3

:

Methanesulfonamide, N-(2-iodophenyl)-

Description:
Methanesulfonamide, N-(2-iodophenyl)-, with the CAS number 116547-92-3, is an organic compound characterized by the presence of a methanesulfonamide functional group attached to a 2-iodophenyl moiety. This compound typically exhibits properties associated with both sulfonamides and aromatic halides, including potential solubility in polar solvents due to the sulfonamide group. The presence of the iodine atom can impart unique reactivity, making it a candidate for various chemical transformations, such as nucleophilic substitutions or coupling reactions. Methanesulfonamide derivatives are often studied for their biological activity, including antimicrobial properties, and may serve as intermediates in the synthesis of pharmaceuticals. The compound's molecular structure suggests it may participate in hydrogen bonding due to the sulfonamide nitrogen, influencing its physical properties such as melting point and boiling point. Additionally, the aromatic ring can contribute to the compound's stability and reactivity under different conditions. Overall, Methanesulfonamide, N-(2-iodophenyl)- is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C7H8INO2S
InChI:InChI=1S/C7H8INO2S/c1-12(10,11)9-7-5-3-2-4-6(7)8/h2-5,9H,1H3
InChI key:LDYJASRWKZXTBH-UHFFFAOYSA-N
SMILES:CS(=O)(=O)NC1=CC=CC=C1I
Found 2 products.