CymitQuimica logo

CAS 116557-46-1

:

3-Bromo-2-methoxyaniline

Description:
3-Bromo-2-methoxyaniline is an organic compound characterized by the presence of a bromine atom, a methoxy group, and an amino group attached to a benzene ring. Its molecular structure features a bromine substituent at the third position and a methoxy group at the second position relative to the amino group. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, such as electrophilic aromatic substitution. Additionally, the methoxy group can influence the compound's reactivity and stability, often acting as an electron-donating group. 3-Bromo-2-methoxyaniline may be utilized in the synthesis of dyes, pharmaceuticals, and agrochemicals, highlighting its significance in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound exemplifies the diverse functionalities that can arise from simple modifications to an aniline structure.
Formula:C7H8BrNO
InChI:InChI=1S/C7H8BrNO/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,9H2,1H3
InChI key:ZLODWCIXZJMLJL-UHFFFAOYSA-N
SMILES:COC1=C(C=CC=C1Br)N
Synonyms:
  • 3-bromo-2-methoxy-Benzenamine
  • 2-Amino-6-bromoanisole
Found 5 products.