CymitQuimica logo

CAS 1166756-82-6

:

Methyl 4-(5-Isopropyl-1,2,4-oxadiazol-3-yl)benzoate

Description:
Methyl 4-(5-Isopropyl-1,2,4-oxadiazol-3-yl)benzoate is a chemical compound characterized by its unique structure, which includes a benzoate moiety and an oxadiazole ring. The presence of the isopropyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. This compound may exhibit biological activity due to the oxadiazole ring, which is known for its presence in various pharmaceuticals and agrochemicals. The methyl ester functional group enhances its reactivity, making it a suitable candidate for further chemical modifications. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, Methyl 4-(5-Isopropyl-1,2,4-oxadiazol-3-yl)benzoate represents a versatile scaffold for research and development in various chemical fields.
Formula:C13H14N2O3
InChI:InChI=1S/C13H14N2O3/c1-8(2)12-14-11(15-18-12)9-4-6-10(7-5-9)13(16)17-3/h4-8H,1-3H3
InChI key:DHQLCHGFDBAXBP-UHFFFAOYSA-N
SMILES:CC(C)C1=NC(=NO1)C2=CC=C(C=C2)C(=O)OC
Synonyms:
  • Benzoic acid, 4-[5-(1-methylethyl)-1,2,4-oxadiazol-3-yl]-, methyl ester
  • Methyl 4-(5-Isopropyl-1,2,4-oxadiazol-3-yl)benzoate
  • 4-[5-(1-methylethyl)-1,2,4-oxadiazol-3-yl]Benzoic acid methyl ester
Found 3 products.