CymitQuimica logo

CAS 116702-65-9

:

3-Amino-2-(4-methylphenylamino)benzoic acid

Description:
3-Amino-2-(4-methylphenylamino)benzoic acid, with the CAS number 116702-65-9, is an organic compound characterized by its amino and carboxylic acid functional groups, which contribute to its acidic properties. This compound features a benzoic acid backbone substituted with amino groups, specifically a 4-methylphenylamino group at the second position and an amino group at the third position. The presence of these functional groups enhances its potential for hydrogen bonding and increases its solubility in polar solvents. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, its unique arrangement of substituents may influence its reactivity and interaction with other chemical species, making it a subject of interest in medicinal chemistry and material science. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C14H14N2O2
InChI:InChI=1/C14H14N2O2/c1-9-5-7-10(8-6-9)16-13-11(14(17)18)3-2-4-12(13)15/h2-8,16H,15H2,1H3,(H,17,18)
InChI key:GTTBSDNXVFGONG-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)Nc1c(cccc1N)C(=O)O
Synonyms:
  • 3-Amino-2-[(4-Methylphenyl)Amino]Benzoic Acid
  • Benzoic Acid, 3-Amino-2-[(4-Methylphenyl)Amino]-
  • 3-Amino-2-(P-Tolylamino)Benzoic Acid
Found 2 products.