CymitQuimica logo

CAS 1167414-88-1

:

(1R)-1-(3-Methylphenyl)ethanamine hydrochloride (1:1)

Description:
(1R)-1-(3-Methylphenyl)ethanamine hydrochloride, with the CAS number 1167414-88-1, is a chemical compound characterized by its amine functional group and a chiral center, which contributes to its specific stereochemistry. This substance is a hydrochloride salt, indicating that it is typically encountered in a solid form, often as a white or off-white crystalline powder. The presence of the 3-methylphenyl group suggests that it has aromatic characteristics, which can influence its solubility and reactivity. As an amine, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. The compound's chiral nature may also impart unique biological activity, making it of interest in pharmaceutical applications. Its hydrochloride form enhances its stability and solubility in aqueous solutions, which is beneficial for various laboratory and industrial processes. Overall, this compound's structural features suggest potential utility in medicinal chemistry and related fields.
Formula:C9H14ClN
InChI:InChI=1S/C9H13N.ClH/c1-7-4-3-5-9(6-7)8(2)10;/h3-6,8H,10H2,1-2H3;1H/t8-;/m1./s1
InChI key:UGZRFRLOFJGHSK-DDWIOCJRSA-N
SMILES:Cc1cccc(c1)[C@@H](C)N.Cl
Synonyms:
  • (R)-1-M-TOLYLETHANAMINE-HCl
Found 3 products.