CymitQuimica logo

CAS 1167437-28-6

:

[2-Chloro-5-(trifluoromethyl)pyridin-4-yl]boronic acid

Description:
[2-Chloro-5-(trifluoromethyl)pyridin-4-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. The compound features a chlorine atom and a trifluoromethyl group at specific positions on the pyridine, which significantly influence its chemical reactivity and properties. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The trifluoromethyl group enhances the lipophilicity and biological activity of the compound, while the chlorine atom can participate in various substitution reactions. This compound is typically used in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a key method for forming carbon-carbon bonds in organic synthesis. Its unique structural features make it a useful building block in the synthesis of more complex molecules, particularly in the fields of agrochemicals and drug discovery.
Formula:C6H4BClF3NO2
InChI:InChI=1S/C6H4BClF3NO2/c8-5-1-4(7(13)14)3(2-12-5)6(9,10)11/h1-2,13-14H
InChI key:GBNMDZQANRHEDY-UHFFFAOYSA-N
SMILES:c1c(c(cnc1Cl)C(F)(F)F)B(O)O
Synonyms:
  • boronic acid, B-[2-chloro-5-(trifluoromethyl)-4-pyridinyl]-
Found 4 products.