CymitQuimica logo

CAS 116797-02-5

:

4-Methyl-1,4′-bipiperidine

Description:
4-Methyl-1,4′-bipiperidine is a chemical compound characterized by its bipiperidine structure, which consists of two piperidine rings connected by a carbon chain, with a methyl group attached to one of the nitrogen atoms in the piperidine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals. The presence of the methyl group can influence its chemical reactivity and solubility, making it a versatile intermediate in various chemical reactions. Additionally, 4-Methyl-1,4′-bipiperidine may exhibit basic properties due to the nitrogen atoms in the piperidine rings, allowing it to participate in protonation and coordination with other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C11H22N2
InChI:InChI=1S/C11H22N2/c1-10-4-8-13(9-5-10)11-2-6-12-7-3-11/h10-12H,2-9H2,1H3
InChI key:InChIKey=MPXFUSKDKWZTPI-UHFFFAOYSA-N
SMILES:CC1CCN(CC1)C2CCNCC2
Synonyms:
  • 1,4′-Bipiperidine, 4-methyl-
  • 4-(4-Methyl-Piperidin-1-Yl)-Piperidine
  • 4-(4-Methyl-Piperidin-1-Yl)-Piperidine >98%
  • 4-(4-Methylpiperidino)piperidine
  • 4-Methyl-1,4'-Bipiperidine
  • Timtec-Bb Sbb010185
  • 4-Methyl-[1,4′]bipiperidinyl
Found 4 products.