CymitQuimica logo

CAS 116934-87-3

:

1,4-Benzenedicarboxylic acid, 2-methyl-, 1-methyl ester

Description:
1,4-Benzenedicarboxylic acid, 2-methyl-, 1-methyl ester, commonly known as dimethyl terephthalate (DMT), is an aromatic compound characterized by its two carboxylate groups and methyl ester functionalities. It appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. This compound is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. DMT is primarily used as an intermediate in the production of polyesters, particularly polyethylene terephthalate (PET), which is widely utilized in textiles and plastic bottles. The compound exhibits moderate toxicity and should be handled with care, as it can cause irritation to the skin, eyes, and respiratory system upon exposure. Its chemical structure contributes to its stability and reactivity, making it a valuable building block in organic synthesis and polymer chemistry. Additionally, DMT can undergo various chemical reactions, including esterification and transesterification, further expanding its utility in industrial applications.
Formula:C10H10O4
InChI:InChI=1S/C10H10O4/c1-6-5-7(9(11)12)3-4-8(6)10(13)14-2/h3-5H,1-2H3,(H,11,12)
InChI key:HFCRSABBNBNZNG-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)C(=O)O)C(=O)OC
Found 4 products.