CAS 117-78-2
:2-Anthraquinonecarboxylic acid
Description:
2-Anthraquinonecarboxylic acid, with the CAS number 117-78-2, is an organic compound that belongs to the class of anthraquinones, which are polycyclic aromatic compounds. It features a carboxylic acid functional group (-COOH) attached to the anthraquinone structure, specifically at the 2-position. This compound typically appears as a solid, often characterized by its yellow to orange color. It is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and acetone. 2-Anthraquinonecarboxylic acid exhibits properties that make it useful in various applications, including dye manufacturing, as it can serve as a precursor for the synthesis of other chemical compounds. Additionally, it may possess biological activity, which has been explored in various studies. Its stability under normal conditions and the ability to undergo various chemical reactions, such as oxidation and reduction, further enhance its utility in organic synthesis and industrial applications.
Formula:C15H8O4
InChI:InChI=1S/C15H8O4/c16-13-9-3-1-2-4-10(9)14(17)12-7-8(15(18)19)5-6-11(12)13/h1-7H,(H,18,19)
InChI key:InChIKey=ASDLSKCKYGVMAI-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC=C(C(O)=O)C2
Synonyms:- 2-Anthracenecarboxylic acid, 9,10-dihydro-9,10-dioxo-
- 2-Anthraquinone Carboxylic Acid
- 2-Anthraquinonecarboxylic acid
- 2-Anthroic acid, 9,10-dihydro-9,10-dioxo-
- 2-Carboxy-9,10-anthraquinone
- 2-Carboxyanthraquinone
- 9,10-Anthraquinone-2-carboxylic acid
- 9,10-Dihydro-9,10-Dioxo-2-Anthra cenecarboxylic Acid
- 9,10-Dihydro-9,10-Dioxo-2-Anthroic Acid
- 9,10-Dihydro-9,10-dioxo-2-anthracenecarboxylic acid
- 9,10-Dioxo-9,10-Dihydroanthracene-2-Carboxylic Acid
- 9,10-Dioxo-9,10-dihydro-2-anthracenecarboxylic acid
- 9,10-Dioxoanthracene-2-carboxylic acid
- Beta-9,10-Dioxoanthracene-2-Carboxylic Acid
- NSC 5001
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Anthraquinone-2-carboxylic Acid
CAS:Formula:C15H8O4Purity:>99.0%(T)Color and Shape:White to Amber powder to crystalMolecular weight:252.239,10-Dioxo-9,10-dihydroanthracene-2-carboxylic acid
CAS:Formula:C15H8O4Purity:97%Color and Shape:SolidMolecular weight:252.225Anthraquinone-2-carboxylic acid, 98%
CAS:Anthraquinone 2-carboxylic acid (AQ) as a novel electron shuttling mediator and attached electron relay for HRP. Efficient method for the generation of hydrogen peroxide by aerobic photooxidation of 2-propanol using anthraquinone-2-carboxylic acid and molecular oxygen is investigated. This Thermo SFormula:C15H8O4Purity:98%Molecular weight:252.232-Anthracenecarboxylic acid, 9,10-dihydro-9,10-dioxo-
CAS:Formula:C15H8O4Purity:95%Color and Shape:SolidMolecular weight:252.2216ANTHRAQUINONE-2-CARBOXYLIC ACID
CAS:ANTHRAQUINONE-2-CARBOXYLIC ACIDFormula:C15H8O4Purity:≥98%Molecular weight:252.22Anthraquinone-2-carboxylic acid
CAS:Anthraquinone-2-carboxylic acidFormula:C15H8O4Purity:95%Color and Shape:SolidMolecular weight:252.22162ANTHRAQUINONE-2-CARBOXYLIC ACID
CAS:Anthraquinone-2-carboxylic acid acts as a potent anti-inflammatory and antinociceptive component in vivo, thus contributing to the immune regulatory role ofFormula:C15H8O4Purity:99.61% - 99.83%Color and Shape:SolidMolecular weight:252.22





