CAS 117068-71-0
:2-BROMO-6-BENZYLOXYPYRIDINE
Description:
2-Bromo-6-benzyloxy-pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a bromine atom and at the 6-position with a benzyloxy group. This compound typically appears as a solid and is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of the benzyloxy group. The bromine substituent introduces a halogen, which can influence the compound's reactivity, particularly in nucleophilic substitution reactions. The benzyloxy group enhances the compound's lipophilicity, making it potentially useful in medicinal chemistry and as a building block in organic synthesis. Additionally, the presence of the pyridine ring may impart basic properties, allowing for interactions with various biological targets. Overall, 2-bromo-6-benzyloxy-pyridine is of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals, due to its unique structural features and potential reactivity.
Formula:C12H10BrNO
InChI:InChI=1/C12H10BrNO/c13-11-7-4-8-12(14-11)15-9-10-5-2-1-3-6-10/h1-8H,9H2
SMILES:c1ccc(cc1)COc1cccc(Br)n1
Synonyms:- 2-Benzyloxy-6-Bromo-Pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Benzyloxy)-6-bromopyridine
CAS:2-(Benzyloxy)-6-bromopyridineFormula:C12H10BrNOPurity:98%Molecular weight:264.122-Bromo-6-benzyloxypyridine
CAS:Formula:C12H10BrNOPurity:>97.0%(GC)Color and Shape:White to Light yellow powder to lumpMolecular weight:264.122-Bromo-6-Benzyloxypyridine
CAS:2-Bromo-6-BenzyloxypyridineFormula:C12H10BrNOPurity:>98%Molecular weight:264.12Pyridine, 2-bromo-6-(phenylmethoxy)-
CAS:Formula:C12H10BrNOPurity:98%Color and Shape:LiquidMolecular weight:264.11792-Bromo-6-benzyloxypyridine
CAS:Formula:C12H10BrNOPurity:98%Color and Shape:SolidMolecular weight:264.1222-Bromo-6-benzyloxypyridine
CAS:2-Bromo-6-benzyloxypyridine is a nitrate compound that has been synthesized to form a new ligand. It has shown magnetic and hydrogenolysis properties. The molecular weight of the compound is 242.2 g/mol. 2-Bromo-6-benzyloxypyridine is soluble in chloroform, ethanol, acetone, and ether. The melting point of this compound is 210 °C, and it crystallizes in the orthorhombic system with a space group Pna21. The crystal x-ray diffraction pattern of this compound was obtained at 100 KV and 40 mA, which showed that the sample contained hydrogen atoms as well as chloride ions. This compound can be used for amination reactions and may also be useful for sodium trifluoroacetate synthesis.Formula:C12H10BrNOPurity:Min. 95%Molecular weight:264.12 g/mol





