CAS 117230-33-8
:Soyasaponin Aa
Description:
Soyasaponin Aa is a natural compound classified as a triterpenoid saponin, primarily derived from soybeans. It is known for its complex structure, which includes a hydrophilic sugar moiety and a hydrophobic aglycone, contributing to its amphiphilic properties. This compound exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer effects, making it of interest in both nutritional and pharmaceutical research. Soyasaponin Aa is also recognized for its ability to interact with cell membranes, which can influence membrane permeability and cellular signaling pathways. Additionally, it has been studied for its role in enhancing the bioavailability of certain nutrients and its potential use as a natural emulsifier in food products. Its safety profile is generally favorable, but like many bioactive compounds, its effects can vary based on dosage and individual response. Overall, Soyasaponin Aa represents a significant area of study within the field of natural products and functional foods.
Formula:C64H100O31
InChI:InChI=1S/C64H100O31/c1-25(68)85-33-23-84-56(50(87-27(3)70)46(33)86-26(2)69)91-45-30(71)22-83-54(44(45)79)95-52-51(80)59(4,5)19-29-28-11-12-35-61(7)15-14-36(62(8,24-67)34(61)13-16-64(35,10)63(28,9)18-17-60(29,52)6)90-58-49(42(77)41(76)47(92-58)53(81)82)94-57-48(40(75)38(73)32(21-66)89-57)93-55-43(78)39(74)37(72)31(20-65)88-55/h11,29-52,54-58,65-67,71-80H,12-24H2,1-10H3,(H,81,82)/t29-,30-,31+,32+,33+,34+,35+,36-,37+,38-,39-,40-,41-,42-,43+,44+,45-,46-,47-,48+,49+,50+,51-,52+,54-,55-,56-,57-,58+,60+,61-,62+,63+,64+/m0/s1
InChI key:InChIKey=KBGJRGWLUHSDLW-HCOXMXEYSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)([C@](CO)(C)[C@@H](O[C@H]4[C@H](O[C@H]5[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@@H](O)[C@@H](O)[C@@H](CO)O5)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O4)CC3)[H])(CC=C7[C@@]2(C)CC[C@]8(C)[C@]7(CC(C)(C)[C@@H](O)[C@H]8O[C@H]9[C@H](O)[C@@H](O[C@H]%10[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)CO%10)[C@@H](O)CO9)[H])[H]
Synonyms:- (3β,4β,21β,22β)-21,23-Dihydroxy-22-[[3-O-(2,3,4-tri-O-acetyl-β-D-xylopyranosyl)-α-L-arabinopyranosyl]oxy]olean-12-en-3-yl O-β-D-glucopyranosyl-(1→2)-O-β-D-galactopyranosyl-(1→2)-β-D-glucopyranosiduronic acid
- Soyasaponin Aa
- Acetylsoyasaponin A4
- β-D-Glucopyranosiduronic acid, (3β,4β,21β,22β)-21,23-dihydroxy-22-[[3-O-(2,3,4-tri-O-acetyl-β-D-xylopyranosyl)-α-L-arabinopyranosyl]oxy]olean-12-en-3-yl O-β-D-glucopyranosyl-(1→2)-O-β-D-galactopyranosyl-(1→2)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Soyasaponin Aa
CAS:Soyasaponin Aa and soyasaponin Ab dose-dependently markedly inhibit adipocyte differentiation and expression of various adipogenic marker genes, through the downregulation of the adipogenesis-related transcription factors PPARγ and C/EBPα in 3T3-L1 adipocytes.Formula:C64H100O31Purity:95%~99%Molecular weight:1365.47Soyasaponin Aa
CAS:Soyasaponins Aa & Ab inhibit fat cell growth and gene markers via PPARγ and C/EBPα± downregulation in 3T3-L1 cells.
Formula:C64H100O31Purity:99.46%Color and Shape:SolidMolecular weight:1365.473Soyasaponin Aa
CAS:Soyasaponin Aa is a bioactive compound, specifically a type of saponin, which is derived from soybeans. As a secondary metabolite produced by plants, Soyasaponin Aa is characterized by its amphipathic structure, which allows it to interact with both lipid and aqueous environments. Its mode of action involves disrupting lipid membranes, which can lead to various biological effects, including cytotoxicity to certain cancer cells, cholesterol-lowering properties, and the modulation of immune responses.
Formula:C64H100O31Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:1,365.46 g/mol





