CymitQuimica logo

CAS 117237-99-7

:

2(1H)-Quinoxalinone,7-methoxy-3-methyl-(9CI)

Description:
2(1H)-Quinoxalinone, 7-methoxy-3-methyl- (CAS 117237-99-7) is a synthetic organic compound characterized by its quinoxalinone core structure, which features a bicyclic system composed of a benzene ring fused to a pyridine-like ring. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of a methoxy group at the 7-position and a methyl group at the 3-position contributes to its unique chemical properties, influencing its solubility, reactivity, and potential interactions with biological targets. It is generally a solid at room temperature and may exhibit moderate stability under standard conditions. The compound's functional groups can participate in various chemical reactions, such as nucleophilic substitutions or electrophilic additions, which are essential for further derivatization in synthetic applications. Additionally, its potential pharmacological properties may include antimicrobial or anticancer activities, warranting further investigation in drug development contexts.
Formula:C10 H10 N2 O2
InChI:InChI=1S/C10H10N2O2/c1-6-10(13)12-9-5-7(14-2)3-4-8(9)11-6/h3-5H,1-2H3,(H,12,13)
InChI key:AAQWKOHIGOPTPD-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C=C(C=C2)OC)NC1=O
Synonyms:
  • 7-Methoxy-3-Methylquinoxalin-2(1H)-One
  • 2(1H)-Quinoxalinone,7-methoxy-3-methyl-
Found 1 products.