CymitQuimica logo

CAS 1172623-99-2

:

(2ξ,5R)-1,5-Anhydro-3,4-dideoxy-5-C-(2,5-difluorophenyl)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-D-glycero-pentitol

Description:
The chemical substance "(2ξ,5R)-1,5-Anhydro-3,4-dideoxy-5-C-(2,5-difluorophenyl)-4-[[[1,1-dimethylethoxy]carbonyl]amino]-D-glycero-pentitol" with CAS number 1172623-99-2 is a complex organic compound characterized by its unique structural features, including a pentitol backbone and multiple functional groups. The presence of the anhydro and dideoxy modifications indicates that it is derived from a sugar alcohol, which contributes to its potential biological activity. The incorporation of a difluorophenyl group suggests enhanced lipophilicity and may influence its interaction with biological targets. Additionally, the presence of a dimethylethoxycarbonyl group indicates potential for further chemical modifications or applications in medicinal chemistry. This compound may exhibit specific stereochemistry, which is crucial for its biological function, particularly in enzyme interactions or receptor binding. Overall, its intricate structure positions it as a candidate for research in fields such as drug development or biochemistry, where understanding its properties and reactivity is essential for potential therapeutic applications.
Formula:C16H21F2NO4
InChI:InChI=1S/C16H21F2NO4/c1-16(2,3)23-15(21)19-13-7-10(20)8-22-14(13)11-6-9(17)4-5-12(11)18/h4-6,10,13-14,20H,7-8H2,1-3H3,(H,19,21)/t10?,13-,14+/m0/s1
InChI key:InChIKey=RYDSJJXCDQFTKF-INPHSSGZSA-N
SMILES:N(C(OC(C)(C)C)=O)[C@@H]1[C@H](OCC(O)C1)C2=C(F)C=CC(F)=C2
Synonyms:
  • (2ξ,5R)-1,5-Anhydro-3,4-dideoxy-5-C-(2,5-difluorophenyl)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-D-glycero-pentitol
  • D-glycero-Pentitol, 1,5-anhydro-3,4-dideoxy-5-C-(2,5-difluorophenyl)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-, (2ξ,5R)-
Found 5 products.