CymitQuimica logo

CAS 117269-67-7

:

2-but-3-enyl-1,3-dichloro-benzene

Description:
2-but-3-enyl-1,3-dichloro-benzene, identified by its CAS number 117269-67-7, is an organic compound characterized by a benzene ring substituted with two chlorine atoms and a but-3-enyl group. The presence of the dichloro substituents indicates that chlorine atoms are located at the 1 and 3 positions of the benzene ring, which can influence the compound's reactivity and physical properties. The but-3-enyl group, which contains a double bond, contributes to the compound's unsaturation, making it more reactive than saturated hydrocarbons. This compound may exhibit properties typical of both aromatic and alkenyl compounds, such as potential for electrophilic substitution reactions and addition reactions at the double bond. Its structure suggests that it could be used in various chemical syntheses or as an intermediate in organic reactions. Additionally, the presence of chlorine atoms may impart specific characteristics such as increased polarity and potential for environmental persistence, which are important considerations in its handling and application.
Formula:C10H10Cl2
InChI:InChI=1/C10H10Cl2/c1-2-3-5-8-9(11)6-4-7-10(8)12/h2,4,6-7H,1,3,5H2
InChI key:ZRBPFCPGZWEQLV-UHFFFAOYSA-N
SMILES:C=CCCc1c(cccc1Cl)Cl
Found 2 products.