CymitQuimica logo

CAS 1172804-60-2

:

4-Piperidinecarboxamide, 4-(cyclopropylamino)-, hydrochloride (1:2)

Description:
4-Piperidinecarboxamide, 4-(cyclopropylamino)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a cyclopropylamino group indicates that a cyclopropyl group is attached to the nitrogen atom of the piperidine, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. This compound may exhibit biological activity, potentially acting as a modulator or inhibitor in various biochemical pathways, although specific pharmacological effects would depend on further empirical studies. Its molecular structure suggests it could interact with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a class of piperidine derivatives that may have significant implications in drug development and therapeutic applications.
Formula:C9H17N3O·2ClH
InChI:InChI=1S/C9H17N3O.2ClH/c10-8(13)9(12-7-1-2-7)3-5-11-6-4-9;;/h7,11-12H,1-6H2,(H2,10,13);2*1H
InChI key:InChIKey=YQIITJNBKJNAEC-UHFFFAOYSA-N
SMILES:N(C1(C(N)=O)CCNCC1)C2CC2.Cl
Synonyms:
  • 4-Piperidinecarboxamide, 4-(cyclopropylamino)-, hydrochloride (1:2)
Found 1 products.