CymitQuimica logo

CAS 117291-44-8

:

3-AMINO-1-INDANONE

Description:
3-Amino-1-indanone is an organic compound characterized by its indanone structure, which consists of a fused benzene and cyclopentane ring with an amino group attached at the 3-position. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the amino group contributes to its reactivity, allowing for various chemical modifications. 3-Amino-1-indanone may exhibit properties such as solubility in polar solvents and moderate stability under standard conditions. Its molecular structure suggests that it could participate in hydrogen bonding, influencing its interactions with other molecules. Additionally, the compound may display biological activity, making it of interest for research in drug design and synthesis. As with many organic compounds, safety precautions should be taken when handling 3-amino-1-indanone, as it may pose health risks if ingested or inhaled.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-4,8H,5,10H2
InChI key:HNXHMCTUYDVMNC-UHFFFAOYSA-N
SMILES:C1C(C2=CC=CC=C2C1=O)N
Found 1 products.