CymitQuimica logo

CAS 117292-19-0

:

Benzoic acid, 3-[(ethylsulfonyl)amino]-

Description:
Benzoic acid, 3-[(ethylsulfonyl)amino]- is an organic compound characterized by the presence of a benzoic acid moiety substituted at the meta position with an ethylsulfonylamino group. This compound features a carboxylic acid functional group, which contributes to its acidic properties, and an ethylsulfonyl group that enhances its solubility in polar solvents. The presence of the sulfonamide functional group can influence its biological activity, potentially making it a candidate for pharmaceutical applications. The molecular structure suggests that it may exhibit both hydrophilic and lipophilic characteristics, allowing for interactions with various biological systems. Additionally, the compound may participate in hydrogen bonding due to the carboxylic acid and sulfonamide functionalities, which can affect its reactivity and interaction with other molecules. Overall, benzoic acid, 3-[(ethylsulfonyl)amino]- is a compound of interest in medicinal chemistry and materials science, with potential applications in drug development and synthesis.
Formula:C9H11NO4S
InChI:InChI=1S/C9H11NO4S/c1-2-15(13,14)10-8-5-3-4-7(6-8)9(11)12/h3-6,10H,2H2,1H3,(H,11,12)
InChI key:QTHHZXQBCFDQAL-UHFFFAOYSA-N
SMILES:CCS(=O)(=O)NC1=CC=CC(=C1)C(=O)O
Found 2 products.