CymitQuimica logo

CAS 1173097-76-1

:

2,3-Bis[amino[(2-aminophenyl)thio]methylene]butanedinitrile ethanol salt

Description:
2,3-Bis[amino[(2-aminophenyl)thio]methylene]butanedinitrile ethanol salt is a complex organic compound characterized by its unique structural features, which include multiple functional groups such as amino, thioether, and nitrile moieties. This compound likely exhibits properties typical of amines and nitriles, including potential basicity and reactivity towards electrophiles. The presence of the ethanol salt form suggests enhanced solubility in polar solvents, which may facilitate its use in various chemical applications. Additionally, the thioether linkage may impart specific electronic properties, influencing its reactivity and interaction with biological systems. Given its intricate structure, this compound may also exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry or materials science. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, including stability, reactivity, and potential applications. As with many complex organic compounds, safety and handling precautions should be observed due to the potential toxicity associated with certain functional groups.
Formula:C18H16N6S2.C2H6O
InChI:InChI=1S/C18H16N6S2.C2H6O/c19-9-11(17(23)25-15-7-3-1-5-13(15)21)12(10-20)18(24)26-16-8-4-2-6-14(16)22;1-2-3/h1-8H,21-24H2;3H,2H2,1H3/b17-11+,18-12+;
InChI key:CFQULUVMLGZVAF-OYJDLGDISA-N
SMILES:CCO.C1=CC=C(C(=C1)N)S/C(=C(/C(=C(/SC2=CC=CC=C2N)\N)/C#N)\C#N)/N
Synonyms:
  • U 0126
Found 6 products.