CAS 1173097-76-1

2,3-Bis[amino[(2-aminophenyl)thio]methylene]butanedinitrile ethanol salt

Description:

2,3-Bis[amino[(2-aminophenyl)thio]methylene]butanedinitrile ethanol salt is a complex organic compound characterized by its unique structural features, which include multiple functional groups such as amino, thioether, and nitrile moieties. This compound likely exhibits properties typical of amines and nitriles, including potential basicity and reactivity towards electrophiles. The presence of the ethanol salt form suggests enhanced solubility in polar solvents, which may facilitate its use in various chemical applications. Additionally, the thioether linkage may impart specific electronic properties, influencing its reactivity and interaction with biological systems. Given its intricate structure, this compound may also exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry or materials science. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, including stability, reactivity, and potential applications. As with many complex organic compounds, safety and handling precautions should be observed due to the potential toxicity associated with certain functional groups.

Formula: C₁₈H₁₆N₆S₂.C₂H₆O

InChI: InChI=1S/C18H16N6S2.C2H6O/c19-9-11(17(23)25-15-7-3-1-5-13(15)21)12(10-20)18(24)26-16-8-4-2-6-14(16)22;1-2-3/h1-8H,21-24H2;3H,2H2,1H3/b17-11+,18-12+;

InChI key: CFQULUVMLGZVAF-OYJDLGDISA-N

SMILES: CCO.C1=CC=C(C(=C1)N)S/C(=C(/C(=C(/SC2=CC=CC=C2N)\N)/C#N)\C#N)/N

Synonyms:

• U 0126

2,3-Bis(amino((2-aminophenyl)thio)methylene)succinonitrile compound with ethanol

CAS: 1173097-76-1

Formula: C₂₀H₂₂N₆OS₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 426.5583

Ref: IN-DA008TKF

U0126-EtOH

CAS: 1173097-76-1

U0126-EtOH

Formula: C₁₈H₁₆N₆S₂·C₂H₆O

Purity: ≥98%

Molecular weight: 426.6

Ref: 54-BUP15437

U0126-EtOH

CAS: 1173097-76-1

2,3-Bis(amino((2-aminophenyl)thio)methylene)succinonitrile compound with ethanol (1:1)

Formula: C₂₀H₂₂N₆OS₂

Purity: 98%

Molecular weight: 426.56

Ref: IN-DG156134

U0126 Ethanol

CAS: 1173097-76-1

U0126 Ethanol

Formula: C₁₈H₁₆N₆S₂·C₂H₅OH

Purity: 98%

Molecular weight: 426.55827

Ref: 54-BISN0130

U0126-EtOH

CAS: 1173097-76-1

U0126-etoh (U0126 Ethanol) is a non-ATP competitive inhibitor of MEK1 (IC50=72 nM) and MEK2 (IC50=58 nM) with selectivity, inhibit autophagy. Low-Cost!

Formula: C₁₈H₁₆N₆S₂·C₂H₆O

Purity: 99.72% - 99.88%

Color and Shape: Solid

Molecular weight: 426.6

Ref: TM-T6223

U 0126 monoethanolate

CAS: 1173097-76-1

Inhibitor of MEK1 and MEK2 kinases

Formula: C₁₈H₁₆N₆S₂•C₂H₆O

Purity: Min. 95%

Color and Shape: White To Beige Solid

Molecular weight: 426.56 g/mol

Ref: 3D-FD43319