CymitQuimica logo

CAS 1173202-61-3

:

(S)-benzyl 4-ethyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide

Description:
(S)-benzyl 4-ethyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide is a chemical compound characterized by its unique structural features, which include a thiazolidine ring and an oxathiazolidine moiety. This compound typically exhibits chirality, with the (S) designation indicating the specific spatial arrangement of its atoms. The presence of a benzyl group contributes to its hydrophobic characteristics, while the ethyl group enhances its molecular complexity. The carboxylate functional group suggests potential reactivity, particularly in esterification or amidation reactions. Additionally, the 2,2-dioxide functionality indicates the presence of two oxo groups, which can influence the compound's stability and reactivity. This compound may be of interest in medicinal chemistry and synthetic organic chemistry due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this compound represents a fascinating example of a heterocyclic organic molecule with diverse applications.
Formula:C12H15NO5S
InChI:InChI=1S/C12H15NO5S/c1-2-11-9-18-19(15,16)13(11)12(14)17-8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3/t11-/m0/s1
InChI key:GNCASVNWNHRHKR-NSHDSACASA-N
SMILES:CC[C@H]1COS(=O)(=O)N1C(=O)OCC2=CC=CC=C2
Synonyms:
  • (S)-3-Cbz-4-ethyl-1,2,3-oxathiazolidine 2,2-dioxide
  • (S)-benzyl 4-ethyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide
  • 1,2,3-Oxathiazolidine-3-carboxylic acid, 4-ethyl-, phenylmethyl ester, 2,2-dioxide, (4S)-
Found 2 products.