CymitQuimica logo

CAS 1173205-83-8

:

3-Aminocyclobutanecarboxylic acid tert-butyl ester

Description:
3-Aminocyclobutanecarboxylic acid tert-butyl ester is a chemical compound characterized by its unique structure, which includes a cyclobutane ring, an amino group, and a carboxylic acid moiety esterified with a tert-butyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential basicity due to the amino group and acidity from the carboxylic acid functionality. The tert-butyl ester enhances its lipophilicity, which can influence its solubility in organic solvents and biological systems. The presence of the cyclobutane ring contributes to its rigidity and may affect its reactivity and interaction with other molecules. This compound may be of interest in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals or as intermediates in chemical reactions. Its specific reactivity and applications would depend on the functional groups present and the overall molecular conformation. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C9H17NO2
InChI:InChI=1S/C9H17NO2/c1-9(2,3)12-8(11)6-4-7(10)5-6/h6-7H,4-5,10H2,1-3H3
InChI key:KNRNVMUJMBOCRF-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C1CC(C1)N
Synonyms:
  • tert-Butyl 3-aminocyclobutanecarboxylate
  • Cyclobutanecarboxylic acid, 3-amino-, 1,1-dimethylethyl ester
Found 3 products.