CymitQuimica logo

CAS 117322-88-0

:

1-(3-TRIFLUOROMETHYLPHENOXY)-2-PROPANONE

Description:
1-(3-Trifluoromethylphenoxy)-2-propanone is an organic compound characterized by its unique structure, which includes a trifluoromethyl group attached to a phenoxy moiety and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its chemical reactivity and stability. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The ketone functional group suggests potential reactivity in nucleophilic addition reactions, while the phenoxy group can participate in hydrogen bonding and other intermolecular interactions. Additionally, this compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and analysis. Overall, 1-(3-trifluoromethylphenoxy)-2-propanone is a versatile compound with applications that may extend to medicinal chemistry and material science, depending on its specific properties and reactivity.
Formula:C10H9F3O2
InChI:InChI=1S/C10H9F3O2/c1-7(14)6-15-9-4-2-3-8(5-9)10(11,12)13/h2-5H,6H2,1H3
InChI key:LFGYKNVJPGEVMJ-UHFFFAOYSA-N
SMILES:CC(=O)COC1=CC=CC(=C1)C(F)(F)F
Found 1 products.