CymitQuimica logo

CAS 117332-47-5

:

3,4-Dichloro-1H-pyrrolo[3,2-c]pyridine

Description:
3,4-Dichloro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of two chlorine atoms at the 3 and 4 positions enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, 3,4-Dichloro-1H-pyrrolo[3,2-c]pyridine may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, this compound represents an interesting subject for research in both synthetic and medicinal chemistry.
Formula:C7H4Cl2N2
InChI:InChI=1S/C7H4Cl2N2/c8-4-3-11-5-1-2-10-7(9)6(4)5/h1-3,11H
InChI key:InChIKey=GLQFIQWONRCSGP-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC=N1)NC=C2Cl
Synonyms:
  • 3,4-Dichloro-1H-pyrrolo[3,2-c]pyridine
  • 1H-Pyrrolo[3,2-c]pyridine, 3,4-dichloro-
Found 3 products.