CymitQuimica logo

CAS 117370-45-3

:

Fmoc-Gly-Phe-OH

Description:
Fmoc-Gly-Phe-OH, or 9-fluorenylmethoxycarbonyl-glycine-phenylalanine, is a protected amino acid commonly used in peptide synthesis. The Fmoc (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions during the synthesis process. This compound features glycine (Gly) and phenylalanine (Phe) as its constituent amino acids, contributing to its properties and reactivity. Fmoc-Gly-Phe-OH is typically a white to off-white solid and is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. Its stability under basic conditions makes it suitable for solid-phase peptide synthesis, where the Fmoc group can be removed under mild basic conditions, facilitating the sequential addition of amino acids. The compound is utilized in the development of various peptides for research and therapeutic applications, particularly in the fields of biochemistry and medicinal chemistry. Proper handling and storage are essential to maintain its integrity and reactivity during synthesis.
Formula:C26H24N2O5
InChI:InChI=1S/C26H24N2O5/c29-24(28-23(25(30)31)14-17-8-2-1-3-9-17)15-27-26(32)33-16-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-23H,14-16H2,(H,27,32)(H,28,29)(H,30,31)/t23-/m0/s1
InChI key:RNFLNNQAFRFTFE-QHCPKHFHSA-N
SMILES:C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Found 6 products.