CymitQuimica logo

CAS 1173721-45-3

:

1H-Pyrrolo[2,3-b]pyridine-2,3-dione, 5-bromo-1-methyl-

Description:
1H-Pyrrolo[2,3-b]pyridine-2,3-dione, 5-bromo-1-methyl- is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 5-position and a methyl group at the 1-position enhances its reactivity and solubility in various solvents. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. Its structure includes two carbonyl groups, which can participate in various chemical reactions, such as nucleophilic additions. The compound's molecular framework allows for potential interactions with biological targets, which may lead to therapeutic applications. Additionally, its stability and reactivity can be influenced by the electronic effects of the bromine and methyl substituents. Overall, 1H-Pyrrolo[2,3-b]pyridine-2,3-dione, 5-bromo-1-methyl- is a valuable compound in research, particularly in the fields of organic synthesis and pharmacology.
Formula:C8H5BrN2O2
InChI:InChI=1S/C8H5BrN2O2/c1-11-7-5(6(12)8(11)13)2-4(9)3-10-7/h2-3H,1H3
InChI key:AJQKBOXVCYDTSS-UHFFFAOYSA-N
SMILES:CN1C2=C(C=C(C=N2)Br)C(=O)C1=O
Found 4 products.