CymitQuimica logo

CAS 117384-45-9

:

(+)-di-tert-butyl L-tartrate

Description:
(+)-Di-tert-butyl L-tartrate is a chiral organic compound that belongs to the class of tartrates, which are derived from tartaric acid. It is characterized by its two tert-butyl groups attached to the tartrate backbone, contributing to its steric bulk and influencing its solubility and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits optical activity due to its chiral centers, making it useful in asymmetric synthesis and as a chiral auxiliary in various chemical reactions. The presence of the tert-butyl groups enhances its stability and solubility in organic solvents, while also providing steric hindrance that can affect the reactivity of the molecule. Additionally, (+)-di-tert-butyl L-tartrate is often employed in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of chiral catalysts. Its unique properties make it a valuable compound in both academic research and industrial applications.
Formula:C12H22O6
InChI:InChI=1/C12H22O6/c1-11(2,3)17-9(15)7(13)8(14)10(16)18-12(4,5)6/h7-8,13-14H,1-6H3/t7-,8-/m1/s1
InChI key:ITWOKJQQGHCDBL-HTQZYQBOSA-N
SMILES:CC(C)(C)OC(=O)[C@@H]([C@H](C(=O)OC(C)(C)C)O)O
Synonyms:
  • L-Tartaric acid di-tert-butyl ester
  • di-tert-butyl (2R,3R)-2,3-dihydroxybutanedioate
Found 7 products.